C15H17NO3 — CID 820399
[4-(hydroxymethyl)-6-methyl-5-phenylmethoxy-3-pyridinyl]methanol (PubChem CID 820399) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is [4-(hydroxymethyl)-6-methyl-5-phenylmethoxy-3-pyridinyl]methanol.
| Compound Name | [4-(hydroxymethyl)-6-methyl-5-phenylmethoxy-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 820399 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | [4-(hydroxymethyl)-6-methyl-5-phenylmethoxy-3-pyridinyl]methanol |
| SMILES | Cc1ncc(CO)c(CO)c1OCc1ccccc1 |
| InChI | InChI=1S/C15H17NO3/c1-11-15(14(9-18)13(8-17)7-16-11)19-10-12-5-3-2-4-6-12/h2-7,17-18H,8-10H2,1H3 |
| InChIKey | QXWLUNCKNWCIIF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |