C11H13NO3 — CID 15613396
[4-(hydroxymethyl)-6-methyl-5-prop-2-ynoxy-3-pyridinyl]methanol (PubChem CID 15613396) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is [4-(hydroxymethyl)-6-methyl-5-prop-2-ynoxy-3-pyridinyl]methanol.
| Compound Name | [4-(hydroxymethyl)-6-methyl-5-prop-2-ynoxy-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 15613396 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | [4-(hydroxymethyl)-6-methyl-5-prop-2-ynoxy-3-pyridinyl]methanol |
| SMILES | C#CCOc1c(C)ncc(CO)c1CO |
| InChI | InChI=1S/C11H13NO3/c1-3-4-15-11-8(2)12-5-9(6-13)10(11)7-14/h1,5,13-14H,4,6-7H2,2H3 |
| InChIKey | RNQAUDMXHWXDKO-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|