C10H17NO4 — CID 68776255
4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;ethanol (PubChem CID 68776255) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;ethanol.
| Compound Name | 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;ethanol |
|---|---|
| PubChem CID | 68776255 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;ethanol |
| SMILES | CCO.Cc1ncc(CO)c(CO)c1O |
| InChI | InChI=1S/C8H11NO3.C2H6O/c1-5-8(12)7(4-11)6(3-10)2-9-5;1-2-3/h2,10-12H,3-4H2,1H3;3H,2H2,1H3 |
| InChIKey | RPYNNTYVYUFEEN-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |