C9H10N2O2S — CID 165352065
4-(hydroxymethyl)-5-(isothiocyanatomethyl)-2-methylpyridin-3-ol (PubChem CID 165352065) has the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. Its IUPAC name is 4-(hydroxymethyl)-5-(isothiocyanatomethyl)-2-methylpyridin-3-ol.
| Compound Name | 4-(hydroxymethyl)-5-(isothiocyanatomethyl)-2-methylpyridin-3-ol |
|---|---|
| PubChem CID | 165352065 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 4-(hydroxymethyl)-5-(isothiocyanatomethyl)-2-methylpyridin-3-ol |
| SMILES | Cc1ncc(CN=C=S)c(CO)c1O |
| InChI | InChI=1S/C9H10N2O2S/c1-6-9(13)8(4-12)7(3-11-6)2-10-5-14/h3,12-13H,2,4H2,1H3 |
| InChIKey | JPGIWUIMONYXOV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|