C9H13N3O2S — CID 3034970
[5-hydroxy-4-(hydroxymethyl)-6-methyl-3-pyridinyl]methylthiourea (PubChem CID 3034970) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is [5-hydroxy-4-(hydroxymethyl)-6-methyl-3-pyridinyl]methylthiourea.
| Compound Name | [5-hydroxy-4-(hydroxymethyl)-6-methyl-3-pyridinyl]methylthiourea |
|---|---|
| PubChem CID | 3034970 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | [5-hydroxy-4-(hydroxymethyl)-6-methyl-3-pyridinyl]methylthiourea |
| SMILES | Cc1ncc(CNC(N)=S)c(CO)c1O |
| InChI | InChI=1S/C9H13N3O2S/c1-5-8(14)7(4-13)6(2-11-5)3-12-9(10)15/h2,13-14H,3-4H2,1H3,(H3,10,12,15) |
| InChIKey | KXUGABXEVDARGM-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|