C9H12N2O2S3 — CID 154312040
[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylsulfanyl carbamodithioate (PubChem CID 154312040) has the molecular formula C9H12N2O2S3 and a molecular weight of 276.41 g/mol. Its IUPAC name is [3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylsulfanyl carbamodithioate.
| Compound Name | [3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylsulfanyl carbamodithioate |
|---|---|
| PubChem CID | 154312040 |
| Molecular Formula | C9H12N2O2S3 |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | [3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylsulfanyl carbamodithioate |
| SMILES | Cc1ncc(CO)c(CSSC(N)=S)c1O |
| InChI | InChI=1S/C9H12N2O2S3/c1-5-8(13)7(4-15-16-9(10)14)6(3-12)2-11-5/h2,12-13H,3-4H2,1H3,(H2,10,14) |
| InChIKey | BVKWPCLUXFYQIE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|