C16H24N4O2S2+2 — CID 7037586
[5-[[[4-(azaniumylmethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyldisulfanyl]methyl]-3-hydroxy-2-methyl-4-pyridinyl]methylazanium (PubChem CID 7037586) has the molecular formula C16H24N4O2S2+2 and a molecular weight of 368.53 g/mol. Its IUPAC name is [5-[[[4-(azaniumylmethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyldisulfanyl]methyl]-3-hydroxy-2-methyl-4-pyridinyl]methylazanium.
| Compound Name | [5-[[[4-(azaniumylmethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyldisulfanyl]methyl]-3-hydroxy-2-methyl-4-pyridinyl]methylazanium |
|---|---|
| PubChem CID | 7037586 |
| Molecular Formula | C16H24N4O2S2+2 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | [5-[[[4-(azaniumylmethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyldisulfanyl]methyl]-3-hydroxy-2-methyl-4-pyridinyl]methylazanium |
| SMILES | Cc1ncc(CSSCc2cnc(C)c(O)c2C[NH3+])c(C[NH3+])c1O |
| InChI | InChI=1S/C16H22N4O2S2/c1-9-15(21)13(3-17)11(5-19-9)7-23-24-8-12-6-20-10(2)16(22)14(12)4-18/h5-6,21-22H,3-4,7-8,17-18H2,1-2H3/p+2 |
| InChIKey | ICRVGGMUHSQAEO-UHFFFAOYSA-P |
| XLogP | 1.07 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|