C12H15NO5 — CID 137357201
methyl 2-[4-(acetyloxymethyl)-5-hydroxy-6-methyl-3-pyridinyl]acetate (PubChem CID 137357201) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is methyl 2-[4-(acetyloxymethyl)-5-hydroxy-6-methyl-3-pyridinyl]acetate.
| Compound Name | methyl 2-[4-(acetyloxymethyl)-5-hydroxy-6-methyl-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 137357201 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | methyl 2-[4-(acetyloxymethyl)-5-hydroxy-6-methyl-3-pyridinyl]acetate |
| SMILES | COC(=O)Cc1cnc(C)c(O)c1COC(C)=O |
| InChI | InChI=1S/C12H15NO5/c1-7-12(16)10(6-18-8(2)14)9(5-13-7)4-11(15)17-3/h5,16H,4,6H2,1-3H3 |
| InChIKey | AFZXLVVGVBLHKU-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |