C20H23NO7 — CID 135331323
[3-hydroxy-2-methyl-5-(pent-4-ynoxycarbonyloxymethyl)-4-pyridinyl]methyl pent-4-ynyl carbonate (PubChem CID 135331323) has the molecular formula C20H23NO7 and a molecular weight of 389.40 g/mol. Its IUPAC name is [3-hydroxy-2-methyl-5-(pent-4-ynoxycarbonyloxymethyl)-4-pyridinyl]methyl pent-4-ynyl carbonate.
| Compound Name | [3-hydroxy-2-methyl-5-(pent-4-ynoxycarbonyloxymethyl)-4-pyridinyl]methyl pent-4-ynyl carbonate |
|---|---|
| PubChem CID | 135331323 |
| Molecular Formula | C20H23NO7 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | [3-hydroxy-2-methyl-5-(pent-4-ynoxycarbonyloxymethyl)-4-pyridinyl]methyl pent-4-ynyl carbonate |
| SMILES | C#CCCCOC(=O)OCc1cnc(C)c(O)c1COC(=O)OCCCC#C |
| InChI | InChI=1S/C20H23NO7/c1-4-6-8-10-25-19(23)27-13-16-12-21-15(3)18(22)17(16)14-28-20(24)26-11-9-7-5-2/h1-2,12,22H,6-11,13-14H2,3H3 |
| InChIKey | HNZYIFIPBLWVCN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|