C14H21NO7 — CID 175280730
4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;hexanedioic acid (PubChem CID 175280730) has the molecular formula C14H21NO7 and a molecular weight of 315.32 g/mol. Its IUPAC name is 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;hexanedioic acid.
| Compound Name | 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;hexanedioic acid |
|---|---|
| PubChem CID | 175280730 |
| Molecular Formula | C14H21NO7 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;hexanedioic acid |
| SMILES | Cc1ncc(CO)c(CO)c1O.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/C8H11NO3.C6H10O4/c1-5-8(12)7(4-11)6(3-10)2-9-5;7-5(8)3-1-2-4-6(9)10/h2,10-12H,3-4H2,1H3;1-4H2,(H,7,8)(H,9,10) |
| InChIKey | WLUFEEDYANFLGA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|