C9H9NO2 — CID 13491773
5-ethynyl-4-(hydroxymethyl)-2-methylpyridin-3-ol (PubChem CID 13491773) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 5-ethynyl-4-(hydroxymethyl)-2-methylpyridin-3-ol.
| Compound Name | 5-ethynyl-4-(hydroxymethyl)-2-methylpyridin-3-ol |
|---|---|
| PubChem CID | 13491773 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 5-ethynyl-4-(hydroxymethyl)-2-methylpyridin-3-ol |
| SMILES | C#Cc1cnc(C)c(O)c1CO |
| InChI | InChI=1S/C9H9NO2/c1-3-7-4-10-6(2)9(12)8(7)5-11/h1,4,11-12H,5H2,2H3 |
| InChIKey | IXBFPLHNJONHNA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|