C10H13NO4 — CID 45097237
ethyl 5-hydroxy-4-(hydroxymethyl)-6-methylpyridine-3-carboxylate (PubChem CID 45097237) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is ethyl 5-hydroxy-4-(hydroxymethyl)-6-methylpyridine-3-carboxylate.
| Compound Name | ethyl 5-hydroxy-4-(hydroxymethyl)-6-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 45097237 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | ethyl 5-hydroxy-4-(hydroxymethyl)-6-methylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(C)c(O)c1CO |
| InChI | InChI=1S/C10H13NO4/c1-3-15-10(14)7-4-11-6(2)9(13)8(7)5-12/h4,12-13H,3,5H2,1-2H3 |
| InChIKey | AJCFBWXUGRKHNO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |