C18H20N2O4 — CID 122232828
diethyl 6-(4,5-dimethyl-2-pyridinyl)pyridine-3,4-dicarboxylate (PubChem CID 122232828) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is diethyl 6-(4,5-dimethyl-2-pyridinyl)pyridine-3,4-dicarboxylate.
| Compound Name | diethyl 6-(4,5-dimethyl-2-pyridinyl)pyridine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 122232828 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | diethyl 6-(4,5-dimethyl-2-pyridinyl)pyridine-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1cnc(-c2cc(C)c(C)cn2)cc1C(=O)OCC |
| InChI | InChI=1S/C18H20N2O4/c1-5-23-17(21)13-8-16(15-7-11(3)12(4)9-19-15)20-10-14(13)18(22)24-6-2/h7-10H,5-6H2,1-4H3 |
| InChIKey | AJYUZSCVLHCVME-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |