C10H15NO3 — CID 15613384
[5-ethoxy-4-(hydroxymethyl)-6-methyl-3-pyridinyl]methanol (PubChem CID 15613384) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is [5-ethoxy-4-(hydroxymethyl)-6-methyl-3-pyridinyl]methanol.
| Compound Name | [5-ethoxy-4-(hydroxymethyl)-6-methyl-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 15613384 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | [5-ethoxy-4-(hydroxymethyl)-6-methyl-3-pyridinyl]methanol |
| SMILES | CCOc1c(C)ncc(CO)c1CO |
| InChI | InChI=1S/C10H15NO3/c1-3-14-10-7(2)11-4-8(5-12)9(10)6-13/h4,12-13H,3,5-6H2,1-2H3 |
| InChIKey | ZEAPCGDIGJWHAT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |