C10H11NO4 — CID 11769724
[4-formyl-5-(hydroxymethyl)-2-methyl-3-pyridinyl] acetate (PubChem CID 11769724) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is [4-formyl-5-(hydroxymethyl)-2-methyl-3-pyridinyl] acetate.
| Compound Name | [4-formyl-5-(hydroxymethyl)-2-methyl-3-pyridinyl] acetate |
|---|---|
| PubChem CID | 11769724 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | [4-formyl-5-(hydroxymethyl)-2-methyl-3-pyridinyl] acetate |
| SMILES | CC(=O)Oc1c(C)ncc(CO)c1C=O |
| InChI | InChI=1S/C10H11NO4/c1-6-10(15-7(2)14)9(5-13)8(4-12)3-11-6/h3,5,12H,4H2,1-2H3 |
| InChIKey | IOKGGTJJDXDKOK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|