C14H11ClN2O5 — CID 89326648
6-chloro-2-[[4-formyl-5-(hydroxymethyl)-2-methyl-3-pyridinyl]oxy]pyridine-3-carboxylic acid (PubChem CID 89326648) has the molecular formula C14H11ClN2O5 and a molecular weight of 322.70 g/mol. Its IUPAC name is 6-chloro-2-[[4-formyl-5-(hydroxymethyl)-2-methyl-3-pyridinyl]oxy]pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-2-[[4-formyl-5-(hydroxymethyl)-2-methyl-3-pyridinyl]oxy]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 89326648 |
| Molecular Formula | C14H11ClN2O5 |
| Molecular Weight | 322.70 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 6-chloro-2-[[4-formyl-5-(hydroxymethyl)-2-methyl-3-pyridinyl]oxy]pyridine-3-carboxylic acid |
| SMILES | Cc1ncc(CO)c(C=O)c1Oc1nc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C14H11ClN2O5/c1-7-12(10(6-19)8(5-18)4-16-7)22-13-9(14(20)21)2-3-11(15)17-13/h2-4,6,18H,5H2,1H3,(H,20,21) |
| InChIKey | NXGGISPHNUCIMV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 109.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.70 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|