C15H18NO5P — CID 10426329
[(2,5-dimethyl-3-phenylmethoxy-4-pyridinyl)-hydroxymethyl]phosphonic acid (PubChem CID 10426329) has the molecular formula C15H18NO5P and a molecular weight of 323.29 g/mol. Its IUPAC name is [(2,5-dimethyl-3-phenylmethoxy-4-pyridinyl)-hydroxymethyl]phosphonic acid.
| Compound Name | [(2,5-dimethyl-3-phenylmethoxy-4-pyridinyl)-hydroxymethyl]phosphonic acid |
|---|---|
| PubChem CID | 10426329 |
| Molecular Formula | C15H18NO5P |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | [(2,5-dimethyl-3-phenylmethoxy-4-pyridinyl)-hydroxymethyl]phosphonic acid |
| SMILES | Cc1cnc(C)c(OCc2ccccc2)c1C(O)P(=O)(O)O |
| InChI | InChI=1S/C15H18NO5P/c1-10-8-16-11(2)14(13(10)15(17)22(18,19)20)21-9-12-6-4-3-5-7-12/h3-8,15,17H,9H2,1-2H3,(H2,18,19,20) |
| InChIKey | KWNNBJFFUBOICM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|