C22H28O — CID 143903536
2-(2,2,5,5-tetramethylhexan-3-yl)dibenzofuran (PubChem CID 143903536) has the molecular formula C22H28O and a molecular weight of 308.47 g/mol. Its IUPAC name is 2-(2,2,5,5-tetramethylhexan-3-yl)dibenzofuran.
| Compound Name | 2-(2,2,5,5-tetramethylhexan-3-yl)dibenzofuran |
|---|---|
| PubChem CID | 143903536 |
| Molecular Formula | C22H28O |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 2-(2,2,5,5-tetramethylhexan-3-yl)dibenzofuran |
| SMILES | CC(C)(C)CC(c1ccc2oc3ccccc3c2c1)C(C)(C)C |
| InChI | InChI=1S/C22H28O/c1-21(2,3)14-18(22(4,5)6)15-11-12-20-17(13-15)16-9-7-8-10-19(16)23-20/h7-13,18H,14H2,1-6H3 |
| InChIKey | VPCQOZLWRVMAOG-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |