C19H15ClN6OS — CID 143903868
N-[3-amino-2-methanimidoyl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]-2-(chloromethyl)-1,3-thiazole-4-carboxamide (PubChem CID 143903868) has the molecular formula C19H15ClN6OS and a molecular weight of 410.89 g/mol. Its IUPAC name is N-[3-amino-2-methanimidoyl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]-2-(chloromethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[3-amino-2-methanimidoyl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]-2-(chloromethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 143903868 |
| Molecular Formula | C19H15ClN6OS |
| Molecular Weight | 410.89 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | N-[3-amino-2-methanimidoyl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]-2-(chloromethyl)-1,3-thiazole-4-carboxamide |
| SMILES | [H]/N=C/c1c(N)cc(-c2ccnc3[nH]ccc23)cc1NC(=O)c1csc(CCl)n1 |
| InChI | InChI=1S/C19H15ClN6OS/c20-7-17-25-16(9-28-17)19(27)26-15-6-10(5-14(22)13(15)8-21)11-1-3-23-18-12(11)2-4-24-18/h1-6,8-9,21H,7,22H2,(H,23,24)(H,26,27)/b21-8+ |
| InChIKey | ZQVRXYWKPVILFU-ODCIPOBUSA-N |
| XLogP | 4.26 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.89 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|