C33H34N6O2S — CID 89122390
N-[2-ethenyl-3-hydrazinyl-5-(1H-indol-4-yl)phenyl]-2-[(3-phenylmethoxypiperidin-1-yl)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 89122390) has the molecular formula C33H34N6O2S and a molecular weight of 578.74 g/mol. Its IUPAC name is N-[2-ethenyl-3-hydrazinyl-5-(1H-indol-4-yl)phenyl]-2-[(3-phenylmethoxypiperidin-1-yl)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-ethenyl-3-hydrazinyl-5-(1H-indol-4-yl)phenyl]-2-[(3-phenylmethoxypiperidin-1-yl)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 89122390 |
| Molecular Formula | C33H34N6O2S |
| Molecular Weight | 578.74 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | N-[2-ethenyl-3-hydrazinyl-5-(1H-indol-4-yl)phenyl]-2-[(3-phenylmethoxypiperidin-1-yl)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | C=Cc1c(NN)cc(-c2cccc3[nH]ccc23)cc1NC(=O)c1csc(CN2CCCC(OCc3ccccc3)C2)n1 |
| InChI | InChI=1S/C33H34N6O2S/c1-2-25-29(16-23(17-30(25)38-34)26-11-6-12-28-27(26)13-14-35-28)37-33(40)31-21-42-32(36-31)19-39-15-7-10-24(18-39)41-20-22-8-4-3-5-9-22/h2-6,8-9,11-14,16-17,21,24,35,38H,1,7,10,15,18-20,34H2,(H,37,40) |
| InChIKey | SWTXPDRVJPJFGT-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.74 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|