C23H30BrF3N2OS — CID 143905395
(2R)-1-[[3-bromo-5-(trifluoromethyl)phenyl]sulfanyl-methylamino]-3-[(2-methyl-5-phenylpentan-2-yl)amino]propan-2-ol (PubChem CID 143905395) has the molecular formula C23H30BrF3N2OS and a molecular weight of 519.47 g/mol. Its IUPAC name is (2R)-1-[[3-bromo-5-(trifluoromethyl)phenyl]sulfanyl-methylamino]-3-[(2-methyl-5-phenylpentan-2-yl)amino]propan-2-ol.
| Compound Name | (2R)-1-[[3-bromo-5-(trifluoromethyl)phenyl]sulfanyl-methylamino]-3-[(2-methyl-5-phenylpentan-2-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 143905395 |
| Molecular Formula | C23H30BrF3N2OS |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | (2R)-1-[[3-bromo-5-(trifluoromethyl)phenyl]sulfanyl-methylamino]-3-[(2-methyl-5-phenylpentan-2-yl)amino]propan-2-ol |
| SMILES | CN(C[C@H](O)CNC(C)(C)CCCc1ccccc1)Sc1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H30BrF3N2OS/c1-22(2,11-7-10-17-8-5-4-6-9-17)28-15-20(30)16-29(3)31-21-13-18(23(25,26)27)12-19(24)14-21/h4-6,8-9,12-14,20,28,30H,7,10-11,15-16H2,1-3H3/t20-/m1/s1 |
| InChIKey | IBHZOWWAVQJFGQ-HXUWFJFHSA-N |
| XLogP | 6.16 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|