C31H24BNO4 — CID 143905959
[18-[2-[(1Z,3Z)-penta-1,3-dienyl]indol-1-yl]-10,14-dioxapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,12,15(20),16,18-octaen-6-yl]boronic acid (PubChem CID 143905959) has the molecular formula C31H24BNO4 and a molecular weight of 485.35 g/mol. Its IUPAC name is [18-[2-[(1Z,3Z)-penta-1,3-dienyl]indol-1-yl]-10,14-dioxapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,12,15(20),16,18-octaen-6-yl]boronic acid.
| Compound Name | [18-[2-[(1Z,3Z)-penta-1,3-dienyl]indol-1-yl]-10,14-dioxapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,12,15(20),16,18-octaen-6-yl]boronic acid |
|---|---|
| PubChem CID | 143905959 |
| Molecular Formula | C31H24BNO4 |
| Molecular Weight | 485.35 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | [18-[2-[(1Z,3Z)-penta-1,3-dienyl]indol-1-yl]-10,14-dioxapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,12,15(20),16,18-octaen-6-yl]boronic acid |
| SMILES | C/C=C\C=C/c1cc2ccccc2n1-c1ccc2oc3cc4oc5c(c4cc3c2c1)C=C(B(O)O)CC5 |
| InChI | InChI=1S/C31H24BNO4/c1-2-3-4-8-21-14-19-7-5-6-9-27(19)33(21)22-11-13-29-24(16-22)26-17-25-23-15-20(32(34)35)10-12-28(23)36-30(25)18-31(26)37-29/h2-9,11,13-18,34-35H,10,12H2,1H3/b3-2-,8-4- |
| InChIKey | NOXFNPRIDOQAQG-BGRWSDHPSA-N |
| XLogP | 7.21 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.35 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|