C19H19N — CID 145348844
1-cyclohexa-1,5-dien-1-yl-2-[(1Z,3Z)-penta-1,3-dienyl]indole (PubChem CID 145348844) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-2-[(1Z,3Z)-penta-1,3-dienyl]indole.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-2-[(1Z,3Z)-penta-1,3-dienyl]indole |
|---|---|
| PubChem CID | 145348844 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-2-[(1Z,3Z)-penta-1,3-dienyl]indole |
| SMILES | C/C=C\C=C/c1cc2ccccc2n1C1=CCCC=C1 |
| InChI | InChI=1S/C19H19N/c1-2-3-5-13-18-15-16-10-8-9-14-19(16)20(18)17-11-6-4-7-12-17/h2-3,5-6,8-15H,4,7H2,1H3/b3-2-,13-5- |
| InChIKey | UNZFHWAETFDCRP-WUCWQLRMSA-N |
| XLogP | 5.42 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|