About 2-[(1Z)-buta-1,3-dienyl]-1-methylindole
2-[(1Z)-buta-1,3-dienyl]-1-methylindole (PubChem CID 142244714) has the molecular formula C13H13N
and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-1-methylindole.
Molecular Properties
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-1-methylindole |
| PubChem CID | 142244714 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-1-methylindole |
| SMILES | C=C/C=C\c1cc2ccccc2n1C |
| InChI | InChI=1S/C13H13N/c1-3-4-8-12-10-11-7-5-6-9-13(11)14(12)2/h3-10H,1H2,2H3/b8-4- |
| InChIKey | IOKKXZLRPVKDAB-YWEYNIOJSA-N |
| XLogP | 3.38 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1Z)-buta-1,3-dienyl]-1-methylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1Z)-buta-1,3-dienyl]-1-methylindole?
The IUPAC name of 2-[(1Z)-buta-1,3-dienyl]-1-methylindole (CID 142244714) is 2-[(1Z)-buta-1,3-dienyl]-1-methylindole.
What is the SMILES notation for 2-[(1Z)-buta-1,3-dienyl]-1-methylindole?
The canonical SMILES for 2-[(1Z)-buta-1,3-dienyl]-1-methylindole is C=C/C=C\c1cc2ccccc2n1C.
What is the InChIKey of 2-[(1Z)-buta-1,3-dienyl]-1-methylindole?
The InChIKey is IOKKXZLRPVKDAB-YWEYNIOJSA-N. The full InChI is InChI=1S/C13H13N/c1-3-4-8-12-10-11-7-5-6-9-13(11)14(12)2/h3-10H,1H2,2H3/b8-4-.
What are the key properties of 2-[(1Z)-buta-1,3-dienyl]-1-methylindole?
2-[(1Z)-buta-1,3-dienyl]-1-methylindole has a molecular weight of 183.25 g/mol, XLogP of 3.38, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1Z)-buta-1,3-dienyl]-1-methylindole is sourced from PubChem (CID 142244714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).