C13H13N — CID 142244714
2-[(1Z)-buta-1,3-dienyl]-1-methylindole (PubChem CID 142244714) has the molecular formula C13H13N and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-1-methylindole.
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-1-methylindole |
|---|---|
| PubChem CID | 142244714 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-1-methylindole |
| SMILES | C=C/C=C\c1cc2ccccc2n1C |
| InChI | InChI=1S/C13H13N/c1-3-4-8-12-10-11-7-5-6-9-13(11)14(12)2/h3-10H,1H2,2H3/b8-4- |
| InChIKey | IOKKXZLRPVKDAB-YWEYNIOJSA-N |
| XLogP | 3.38 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|