C14H15NO2 — CID 14358702
2-[(E)-2-(1,3-dioxolan-2-yl)ethenyl]-1-methylindole (PubChem CID 14358702) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-[(E)-2-(1,3-dioxolan-2-yl)ethenyl]-1-methylindole.
| Compound Name | 2-[(E)-2-(1,3-dioxolan-2-yl)ethenyl]-1-methylindole |
|---|---|
| PubChem CID | 14358702 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-[(E)-2-(1,3-dioxolan-2-yl)ethenyl]-1-methylindole |
| SMILES | Cn1c(/C=C/C2OCCO2)cc2ccccc21 |
| InChI | InChI=1S/C14H15NO2/c1-15-12(6-7-14-16-8-9-17-14)10-11-4-2-3-5-13(11)15/h2-7,10,14H,8-9H2,1H3/b7-6+ |
| InChIKey | SCXGZESTVAYBLL-VOTSOKGWSA-N |
| XLogP | 2.56 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |