C20H18BrNO2 — CID 143906558
2-[1-(4-bromophenyl)-3-methylcyclobutyl]-8H-cyclohepta[c]pyrrole-1,3-dione (PubChem CID 143906558) has the molecular formula C20H18BrNO2 and a molecular weight of 384.27 g/mol. Its IUPAC name is 2-[1-(4-bromophenyl)-3-methylcyclobutyl]-8H-cyclohepta[c]pyrrole-1,3-dione.
| Compound Name | 2-[1-(4-bromophenyl)-3-methylcyclobutyl]-8H-cyclohepta[c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 143906558 |
| Molecular Formula | C20H18BrNO2 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 2-[1-(4-bromophenyl)-3-methylcyclobutyl]-8H-cyclohepta[c]pyrrole-1,3-dione |
| SMILES | CC1CC(c2ccc(Br)cc2)(N2C(=O)C3=C(CC=CC=C3)C2=O)C1 |
| InChI | InChI=1S/C20H18BrNO2/c1-13-11-20(12-13,14-7-9-15(21)10-8-14)22-18(23)16-5-3-2-4-6-17(16)19(22)24/h2-5,7-10,13H,6,11-12H2,1H3 |
| InChIKey | IYYHZKPQOKJTPE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|