C20H26N8O — CID 143907941
2-[2-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-4-pyridinyl]-N-methyl-6-piperazin-1-ylpyridine-4-carboxamide (PubChem CID 143907941) has the molecular formula C20H26N8O and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-[2-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-4-pyridinyl]-N-methyl-6-piperazin-1-ylpyridine-4-carboxamide.
| Compound Name | 2-[2-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-4-pyridinyl]-N-methyl-6-piperazin-1-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 143907941 |
| Molecular Formula | C20H26N8O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 2-[2-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-4-pyridinyl]-N-methyl-6-piperazin-1-ylpyridine-4-carboxamide |
| SMILES | CN/C=C\C(N)=N\c1cc(-c2cc(C(=O)NC)cc(N3CCNCC3)n2)ccn1 |
| InChI | InChI=1S/C20H26N8O/c1-22-5-4-17(21)27-18-12-14(3-6-25-18)16-11-15(20(29)23-2)13-19(26-16)28-9-7-24-8-10-28/h3-6,11-13,22,24H,7-10H2,1-2H3,(H,23,29)(H2,21,25,27)/b5-4- |
| InChIKey | OHNQUCSNYSITEG-PLNGDYQASA-N |
| XLogP | 0.63 |
| TPSA | 120.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|