C20H16ClF3N6O — CID 143908065
1-[3-[7-(6-chloro-1,2-dihydropyridazin-3-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 143908065) has the molecular formula C20H16ClF3N6O and a molecular weight of 448.84 g/mol. Its IUPAC name is 1-[3-[7-(6-chloro-1,2-dihydropyridazin-3-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[3-[7-(6-chloro-1,2-dihydropyridazin-3-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 143908065 |
| Molecular Formula | C20H16ClF3N6O |
| Molecular Weight | 448.84 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 1-[3-[7-(6-chloro-1,2-dihydropyridazin-3-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)Nc1cccc(-c2cnc3cc(C4=CC=C(Cl)NN4)ccn23)c1 |
| InChI | InChI=1S/C20H16ClF3N6O/c21-17-5-4-15(28-29-17)12-6-7-30-16(10-25-18(30)9-12)13-2-1-3-14(8-13)27-19(31)26-11-20(22,23)24/h1-10,28-29H,11H2,(H2,26,27,31) |
| InChIKey | AQYQBFFSOXUJED-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.84 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|