C24H30BF3N4O3 — CID 143908158
ethane;1-[3-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 143908158) has the molecular formula C24H30BF3N4O3 and a molecular weight of 490.34 g/mol. Its IUPAC name is ethane;1-[3-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | ethane;1-[3-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 143908158 |
| Molecular Formula | C24H30BF3N4O3 |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | ethane;1-[3-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CC.CC1(C)OB(c2ccn3c(-c4cccc(NC(=O)NCC(F)(F)F)c4)cnc3c2)OC1(C)C |
| InChI | InChI=1S/C22H24BF3N4O3.C2H6/c1-20(2)21(3,4)33-23(32-20)15-8-9-30-17(12-27-18(30)11-15)14-6-5-7-16(10-14)29-19(31)28-13-22(24,25)26;1-2/h5-12H,13H2,1-4H3,(H2,28,29,31);1-2H3 |
| InChIKey | OPKQWYUOAWXTDL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|