About but-3-en-2-imine;N-methylmethanamine
but-3-en-2-imine;N-methylmethanamine (PubChem CID 143908305) has the molecular formula C6H14N2
and a molecular weight of 114.19 g/mol. Its IUPAC name is but-3-en-2-imine;N-methylmethanamine.
Molecular Properties
| Compound Name | but-3-en-2-imine;N-methylmethanamine |
| PubChem CID | 143908305 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | but-3-en-2-imine;N-methylmethanamine |
| SMILES | CNC.[H]/N=C(\C)C=C |
| InChI | InChI=1S/C4H7N.C2H7N/c1-3-4(2)5;1-3-2/h3,5H,1H2,2H3;3H,1-2H3/b5-4+; |
| InChIKey | KBSFBAZTOQJZTM-FXRZFVDSSA-N |
| XLogP | 1.05 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze but-3-en-2-imine;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-en-2-imine;N-methylmethanamine?
The IUPAC name of but-3-en-2-imine;N-methylmethanamine (CID 143908305) is but-3-en-2-imine;N-methylmethanamine.
What is the SMILES notation for but-3-en-2-imine;N-methylmethanamine?
The canonical SMILES for but-3-en-2-imine;N-methylmethanamine is CNC.[H]/N=C(\C)C=C.
What is the InChIKey of but-3-en-2-imine;N-methylmethanamine?
The InChIKey is KBSFBAZTOQJZTM-FXRZFVDSSA-N. The full InChI is InChI=1S/C4H7N.C2H7N/c1-3-4(2)5;1-3-2/h3,5H,1H2,2H3;3H,1-2H3/b5-4+;.
What are the key properties of but-3-en-2-imine;N-methylmethanamine?
but-3-en-2-imine;N-methylmethanamine has a molecular weight of 114.19 g/mol, XLogP of 1.05, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-en-2-imine;N-methylmethanamine is sourced from PubChem (CID 143908305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).