C26H27N5 — CID 143910519
3-[(1-ethylpiperidin-4-yl)methyl]-4-prop-1-ynyl-12-pyridin-4-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 143910519) has the molecular formula C26H27N5 and a molecular weight of 409.54 g/mol. Its IUPAC name is 3-[(1-ethylpiperidin-4-yl)methyl]-4-prop-1-ynyl-12-pyridin-4-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 3-[(1-ethylpiperidin-4-yl)methyl]-4-prop-1-ynyl-12-pyridin-4-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 143910519 |
| Molecular Formula | C26H27N5 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 3-[(1-ethylpiperidin-4-yl)methyl]-4-prop-1-ynyl-12-pyridin-4-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | CC#Cc1ncc2[nH]c3ncc(-c4ccncc4)cc3c2c1CC1CCN(CC)CC1 |
| InChI | InChI=1S/C26H27N5/c1-3-5-23-21(14-18-8-12-31(4-2)13-9-18)25-22-15-20(19-6-10-27-11-7-19)16-29-26(22)30-24(25)17-28-23/h6-7,10-11,15-18H,4,8-9,12-14H2,1-2H3,(H,29,30) |
| InChIKey | MRWNPQBOFGQUAU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|