C21H16ClFN2S2 — CID 143910984
4-[1-amino-2-(4-chlorophenyl)sulfanyl-3-(4-fluorophenyl)iminoprop-1-enyl]benzenethiol (PubChem CID 143910984) has the molecular formula C21H16ClFN2S2 and a molecular weight of 414.96 g/mol. Its IUPAC name is 4-[1-amino-2-(4-chlorophenyl)sulfanyl-3-(4-fluorophenyl)iminoprop-1-enyl]benzenethiol.
| Compound Name | 4-[1-amino-2-(4-chlorophenyl)sulfanyl-3-(4-fluorophenyl)iminoprop-1-enyl]benzenethiol |
|---|---|
| PubChem CID | 143910984 |
| Molecular Formula | C21H16ClFN2S2 |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | 4-[1-amino-2-(4-chlorophenyl)sulfanyl-3-(4-fluorophenyl)iminoprop-1-enyl]benzenethiol |
| SMILES | NC(=C(/C=N/c1ccc(F)cc1)Sc1ccc(Cl)cc1)c1ccc(S)cc1 |
| InChI | InChI=1S/C21H16ClFN2S2/c22-15-3-11-19(12-4-15)27-20(13-25-17-7-5-16(23)6-8-17)21(24)14-1-9-18(26)10-2-14/h1-13,26H,24H2/b21-20?,25-13+ |
| InChIKey | WKRGFXUWBIEDBI-QMLACYFHSA-N |
| XLogP | 6.59 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|