C22H17ClFNS — CID 68859873
3-(4-chlorophenyl)-3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-en-1-imine (PubChem CID 68859873) has the molecular formula C22H17ClFNS and a molecular weight of 381.90 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-en-1-imine.
| Compound Name | 3-(4-chlorophenyl)-3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 68859873 |
| Molecular Formula | C22H17ClFNS |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 3-(4-chlorophenyl)-3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-en-1-imine |
| SMILES | Cc1ccc(/N=C/C=C(Sc2ccc(F)cc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H17ClFNS/c1-16-2-10-20(11-3-16)25-15-14-22(17-4-6-18(23)7-5-17)26-21-12-8-19(24)9-13-21/h2-15H,1H3/b22-14?,25-15+ |
| InChIKey | QICSOGGRSCQEJJ-AVYJOBCZSA-N |
| XLogP | 7.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|