C23H24N2O — CID 143913137
N-(3,4-dimethylphenyl)-2-phenyl-N-(2-pyridin-2-ylethyl)acetamide (PubChem CID 143913137) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-phenyl-N-(2-pyridin-2-ylethyl)acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-phenyl-N-(2-pyridin-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 143913137 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-phenyl-N-(2-pyridin-2-ylethyl)acetamide |
| SMILES | Cc1ccc(N(CCc2ccccn2)C(=O)Cc2ccccc2)cc1C |
| InChI | InChI=1S/C23H24N2O/c1-18-11-12-22(16-19(18)2)25(15-13-21-10-6-7-14-24-21)23(26)17-20-8-4-3-5-9-20/h3-12,14,16H,13,15,17H2,1-2H3 |
| InChIKey | RKZUPXGYPKMCLB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |