C19H23Cl2N5O — CID 143913870
N'-amino-4-[2-[3,5-dichloro-2-oxo-6-(pyrrolidin-1-ylmethyl)-1-pyridinyl]ethyl]benzenecarboximidamide (PubChem CID 143913870) has the molecular formula C19H23Cl2N5O and a molecular weight of 408.33 g/mol. Its IUPAC name is N'-amino-4-[2-[3,5-dichloro-2-oxo-6-(pyrrolidin-1-ylmethyl)-1-pyridinyl]ethyl]benzenecarboximidamide.
| Compound Name | N'-amino-4-[2-[3,5-dichloro-2-oxo-6-(pyrrolidin-1-ylmethyl)-1-pyridinyl]ethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 143913870 |
| Molecular Formula | C19H23Cl2N5O |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N'-amino-4-[2-[3,5-dichloro-2-oxo-6-(pyrrolidin-1-ylmethyl)-1-pyridinyl]ethyl]benzenecarboximidamide |
| SMILES | N/N=C(\N)c1ccc(CCn2c(CN3CCCC3)c(Cl)cc(Cl)c2=O)cc1 |
| InChI | InChI=1S/C19H23Cl2N5O/c20-15-11-16(21)19(27)26(17(15)12-25-8-1-2-9-25)10-7-13-3-5-14(6-4-13)18(22)24-23/h3-6,11H,1-2,7-10,12,23H2,(H2,22,24) |
| InChIKey | WLDNWSWNPVILSF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 89.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|