C30H51FN5O3P — CID 143914359
N-[5-(azetidine-1-carbonyl)piperidin-3-yl]-5-fluoro-1-(4-methoxybutyl)-N-(2-methylpropyl)-6-phosphanylbenzimidazole-2-carboxamide;ethane (PubChem CID 143914359) has the molecular formula C30H51FN5O3P and a molecular weight of 579.74 g/mol. Its IUPAC name is N-[5-(azetidine-1-carbonyl)piperidin-3-yl]-5-fluoro-1-(4-methoxybutyl)-N-(2-methylpropyl)-6-phosphanylbenzimidazole-2-carboxamide;ethane.
| Compound Name | N-[5-(azetidine-1-carbonyl)piperidin-3-yl]-5-fluoro-1-(4-methoxybutyl)-N-(2-methylpropyl)-6-phosphanylbenzimidazole-2-carboxamide;ethane |
|---|---|
| PubChem CID | 143914359 |
| Molecular Formula | C30H51FN5O3P |
| Molecular Weight | 579.74 g/mol |
| Exact Mass | 579.37 |
| IUPAC Name | N-[5-(azetidine-1-carbonyl)piperidin-3-yl]-5-fluoro-1-(4-methoxybutyl)-N-(2-methylpropyl)-6-phosphanylbenzimidazole-2-carboxamide;ethane |
| SMILES | CC.CC.COCCCCn1c(C(=O)N(CC(C)C)C2CNCC(C(=O)N3CCC3)C2)nc2cc(F)c(P)cc21 |
| InChI | InChI=1S/C26H39FN5O3P.2C2H6/c1-17(2)16-32(19-11-18(14-28-15-19)25(33)30-7-6-8-30)26(34)24-29-21-12-20(27)23(36)13-22(21)31(24)9-4-5-10-35-3;2*1-2/h12-13,17-19,28H,4-11,14-16,36H2,1-3H3;2*1-2H3 |
| InChIKey | GOLLAYNFZKVUBT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.74 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|