C26H40FN5O3 — CID 163540807
azetidin-1-yl-[(5S)-5-[[[5-fluoro-1-(4-methoxybutyl)benzimidazol-2-yl]-hydroxymethyl]-(2-methylpropyl)amino]piperidin-3-yl]methanone (PubChem CID 163540807) has the molecular formula C26H40FN5O3 and a molecular weight of 489.64 g/mol. Its IUPAC name is azetidin-1-yl-[(5S)-5-[[[5-fluoro-1-(4-methoxybutyl)benzimidazol-2-yl]-hydroxymethyl]-(2-methylpropyl)amino]piperidin-3-yl]methanone.
| Compound Name | azetidin-1-yl-[(5S)-5-[[[5-fluoro-1-(4-methoxybutyl)benzimidazol-2-yl]-hydroxymethyl]-(2-methylpropyl)amino]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 163540807 |
| Molecular Formula | C26H40FN5O3 |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | azetidin-1-yl-[(5S)-5-[[[5-fluoro-1-(4-methoxybutyl)benzimidazol-2-yl]-hydroxymethyl]-(2-methylpropyl)amino]piperidin-3-yl]methanone |
| SMILES | COCCCCn1c(C(O)N(CC(C)C)[C@@H]2CNCC(C(=O)N3CCC3)C2)nc2cc(F)ccc21 |
| InChI | InChI=1S/C26H40FN5O3/c1-18(2)17-32(21-13-19(15-28-16-21)25(33)30-9-6-10-30)26(34)24-29-22-14-20(27)7-8-23(22)31(24)11-4-5-12-35-3/h7-8,14,18-19,21,26,28,34H,4-6,9-13,15-17H2,1-3H3/t19?,21-,26?/m0/s1 |
| InChIKey | FAXWAFLKTNLPQW-AHRWMNNESA-N |
| XLogP | 2.76 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|