C29H46N4O4 — CID 146764243
1-[(3R,5S)-5-[[hydroxy-[1-(3-methoxypropyl)benzimidazol-2-yl]methyl]-(2-methylpropyl)amino]piperidin-3-yl]-3-(oxan-4-yl)propan-1-one (PubChem CID 146764243) has the molecular formula C29H46N4O4 and a molecular weight of 514.71 g/mol. Its IUPAC name is 1-[(3R,5S)-5-[[hydroxy-[1-(3-methoxypropyl)benzimidazol-2-yl]methyl]-(2-methylpropyl)amino]piperidin-3-yl]-3-(oxan-4-yl)propan-1-one.
| Compound Name | 1-[(3R,5S)-5-[[hydroxy-[1-(3-methoxypropyl)benzimidazol-2-yl]methyl]-(2-methylpropyl)amino]piperidin-3-yl]-3-(oxan-4-yl)propan-1-one |
|---|---|
| PubChem CID | 146764243 |
| Molecular Formula | C29H46N4O4 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.35 |
| IUPAC Name | 1-[(3R,5S)-5-[[hydroxy-[1-(3-methoxypropyl)benzimidazol-2-yl]methyl]-(2-methylpropyl)amino]piperidin-3-yl]-3-(oxan-4-yl)propan-1-one |
| SMILES | COCCCn1c(C(O)N(CC(C)C)[C@@H]2CNC[C@H](C(=O)CCC3CCOCC3)C2)nc2ccccc21 |
| InChI | InChI=1S/C29H46N4O4/c1-21(2)20-33(24-17-23(18-30-19-24)27(34)10-9-22-11-15-37-16-12-22)29(35)28-31-25-7-4-5-8-26(25)32(28)13-6-14-36-3/h4-5,7-8,21-24,29-30,35H,6,9-20H2,1-3H3/t23-,24+,29?/m1/s1 |
| InChIKey | RQCUEYZHYONWNX-LLZOBTIZSA-N |
| XLogP | 3.78 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|