C34H57FN6O5 — CID 143914414
butane;tert-butyl 3-[[(Z)-2-amino-3-(N-amino-2-fluoroanilino)pent-2-enoyl]-(2-methylpropyl)amino]-5-(morpholine-4-carbonyl)piperidine-1-carboxylate (PubChem CID 143914414) has the molecular formula C34H57FN6O5 and a molecular weight of 648.87 g/mol. Its IUPAC name is butane;tert-butyl 3-[[(Z)-2-amino-3-(N-amino-2-fluoroanilino)pent-2-enoyl]-(2-methylpropyl)amino]-5-(morpholine-4-carbonyl)piperidine-1-carboxylate.
| Compound Name | butane;tert-butyl 3-[[(Z)-2-amino-3-(N-amino-2-fluoroanilino)pent-2-enoyl]-(2-methylpropyl)amino]-5-(morpholine-4-carbonyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 143914414 |
| Molecular Formula | C34H57FN6O5 |
| Molecular Weight | 648.87 g/mol |
| Exact Mass | 648.44 |
| IUPAC Name | butane;tert-butyl 3-[[(Z)-2-amino-3-(N-amino-2-fluoroanilino)pent-2-enoyl]-(2-methylpropyl)amino]-5-(morpholine-4-carbonyl)piperidine-1-carboxylate |
| SMILES | CC/C(=C(/N)C(=O)N(CC(C)C)C1CC(C(=O)N2CCOCC2)CN(C(=O)OC(C)(C)C)C1)N(N)c1ccccc1F.CCCC |
| InChI | InChI=1S/C30H47FN6O5.C4H10/c1-7-24(37(33)25-11-9-8-10-23(25)31)26(32)28(39)36(17-20(2)3)22-16-21(27(38)34-12-14-41-15-13-34)18-35(19-22)29(40)42-30(4,5)6;1-3-4-2/h8-11,20-22H,7,12-19,32-33H2,1-6H3;3-4H2,1-2H3/b26-24-; |
| InChIKey | PCJZQSFPHGKHLW-FSKGQQLBSA-N |
| XLogP | 4.86 |
| TPSA | 134.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.87 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|