C23H39N3O8+ — CID 132577907
CID 132577907 (PubChem CID 132577907) has the molecular formula C23H39N3O8+ and a molecular weight of 485.58 g/mol.
| Compound Name | CID 132577907 |
|---|---|
| PubChem CID | 132577907 |
| Molecular Formula | C23H39N3O8+ |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | — |
| SMILES | CC(C)CN(OC(=[O+])CCC(=O)O)[C@H]1C[C@@H](C(=O)N2CCOCC2)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C23H39N3O8/c1-16(2)13-26(34-20(29)7-6-19(27)28)18-12-17(21(30)24-8-10-32-11-9-24)14-25(15-18)22(31)33-23(3,4)5/h16-18H,6-15H2,1-5H3,(H,27,28)/q+1/t17-,18+/m1/s1 |
| InChIKey | SSECQZHUBPTXME-MSOLQXFVSA-N |
| XLogP | 1.75 |
| TPSA | 128.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|