C18H33N3O4S — CID 151062802
tert-butyl (3R,5S)-3-(morpholine-4-carbonyl)-5-(2-sulfanylpropylamino)piperidine-1-carboxylate (PubChem CID 151062802) has the molecular formula C18H33N3O4S and a molecular weight of 387.55 g/mol. Its IUPAC name is tert-butyl (3R,5S)-3-(morpholine-4-carbonyl)-5-(2-sulfanylpropylamino)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,5S)-3-(morpholine-4-carbonyl)-5-(2-sulfanylpropylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 151062802 |
| Molecular Formula | C18H33N3O4S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | tert-butyl (3R,5S)-3-(morpholine-4-carbonyl)-5-(2-sulfanylpropylamino)piperidine-1-carboxylate |
| SMILES | CC(S)CN[C@H]1C[C@@H](C(=O)N2CCOCC2)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H33N3O4S/c1-13(26)10-19-15-9-14(16(22)20-5-7-24-8-6-20)11-21(12-15)17(23)25-18(2,3)4/h13-15,19,26H,5-12H2,1-4H3/t13?,14-,15+/m1/s1 |
| InChIKey | MGNHAYBPPKVELM-DMJDIKPUSA-N |
| XLogP | 1.38 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|