C18H35N3O3 — CID 113231791
tert-butyl 3-[(4-methyl-2-morpholin-4-ylpentyl)amino]azetidine-1-carboxylate (PubChem CID 113231791) has the molecular formula C18H35N3O3 and a molecular weight of 341.50 g/mol. Its IUPAC name is tert-butyl 3-[(4-methyl-2-morpholin-4-ylpentyl)amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(4-methyl-2-morpholin-4-ylpentyl)amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 113231791 |
| Molecular Formula | C18H35N3O3 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.27 |
| IUPAC Name | tert-butyl 3-[(4-methyl-2-morpholin-4-ylpentyl)amino]azetidine-1-carboxylate |
| SMILES | CC(C)CC(CNC1CN(C(=O)OC(C)(C)C)C1)N1CCOCC1 |
| InChI | InChI=1S/C18H35N3O3/c1-14(2)10-16(20-6-8-23-9-7-20)11-19-15-12-21(13-15)17(22)24-18(3,4)5/h14-16,19H,6-13H2,1-5H3 |
| InChIKey | KEXQDNLOBUZHPY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |