C17H19FN2O — CID 143915081
N-[(E)-2-[(6-methoxy-1H-indol-2-yl)methyl]but-1-enyl]prop-2-enimidoyl fluoride (PubChem CID 143915081) has the molecular formula C17H19FN2O and a molecular weight of 286.35 g/mol. Its IUPAC name is N-[(E)-2-[(6-methoxy-1H-indol-2-yl)methyl]but-1-enyl]prop-2-enimidoyl fluoride.
| Compound Name | N-[(E)-2-[(6-methoxy-1H-indol-2-yl)methyl]but-1-enyl]prop-2-enimidoyl fluoride |
|---|---|
| PubChem CID | 143915081 |
| Molecular Formula | C17H19FN2O |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N-[(E)-2-[(6-methoxy-1H-indol-2-yl)methyl]but-1-enyl]prop-2-enimidoyl fluoride |
| SMILES | C=C/C(F)=N/C=C(\CC)Cc1cc2ccc(OC)cc2[nH]1 |
| InChI | InChI=1S/C17H19FN2O/c1-4-12(11-19-17(18)5-2)8-14-9-13-6-7-15(21-3)10-16(13)20-14/h5-7,9-11,20H,2,4,8H2,1,3H3/b12-11+,19-17- |
| InChIKey | YZMQBXJKYFWXCH-IPDVDUOXSA-N |
| XLogP | 4.57 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|