C26H28N4O3 — CID 143915156
(2Z)-5-amino-2-[[5-methoxy-2-(1,3,5-trimethylpyrazol-4-yl)-1H-indol-3-yl]methylidene]-1-benzofuran-3-one;ethane (PubChem CID 143915156) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is (2Z)-5-amino-2-[[5-methoxy-2-(1,3,5-trimethylpyrazol-4-yl)-1H-indol-3-yl]methylidene]-1-benzofuran-3-one;ethane.
| Compound Name | (2Z)-5-amino-2-[[5-methoxy-2-(1,3,5-trimethylpyrazol-4-yl)-1H-indol-3-yl]methylidene]-1-benzofuran-3-one;ethane |
|---|---|
| PubChem CID | 143915156 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | (2Z)-5-amino-2-[[5-methoxy-2-(1,3,5-trimethylpyrazol-4-yl)-1H-indol-3-yl]methylidene]-1-benzofuran-3-one;ethane |
| SMILES | CC.COc1ccc2[nH]c(-c3c(C)nn(C)c3C)c(/C=C3\Oc4ccc(N)cc4C3=O)c2c1 |
| InChI | InChI=1S/C24H22N4O3.C2H6/c1-12-22(13(2)28(3)27-12)23-17(16-10-15(30-4)6-7-19(16)26-23)11-21-24(29)18-9-14(25)5-8-20(18)31-21;1-2/h5-11,26H,25H2,1-4H3;1-2H3/b21-11-; |
| InChIKey | BNJODWPOAUHJDD-KELDOBJCSA-N |
| XLogP | 5.42 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|