C28H25N3O6 — CID 58004670
1-[(2Z)-2-[[2-(2,6-dimethoxyphenyl)-5-methoxy-1H-indol-3-yl]methylidene]-3-oxo-1-benzofuran-5-yl]-3-methylurea (PubChem CID 58004670) has the molecular formula C28H25N3O6 and a molecular weight of 499.52 g/mol. Its IUPAC name is 1-[(2Z)-2-[[2-(2,6-dimethoxyphenyl)-5-methoxy-1H-indol-3-yl]methylidene]-3-oxo-1-benzofuran-5-yl]-3-methylurea.
| Compound Name | 1-[(2Z)-2-[[2-(2,6-dimethoxyphenyl)-5-methoxy-1H-indol-3-yl]methylidene]-3-oxo-1-benzofuran-5-yl]-3-methylurea |
|---|---|
| PubChem CID | 58004670 |
| Molecular Formula | C28H25N3O6 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 1-[(2Z)-2-[[2-(2,6-dimethoxyphenyl)-5-methoxy-1H-indol-3-yl]methylidene]-3-oxo-1-benzofuran-5-yl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc2c(c1)C(=O)/C(=C/c1c(-c3c(OC)cccc3OC)[nH]c3ccc(OC)cc13)O2 |
| InChI | InChI=1S/C28H25N3O6/c1-29-28(33)30-15-8-11-21-19(12-15)27(32)24(37-21)14-18-17-13-16(34-2)9-10-20(17)31-26(18)25-22(35-3)6-5-7-23(25)36-4/h5-14,31H,1-4H3,(H2,29,30,33)/b24-14- |
| InChIKey | WPHDRIRYXQLREK-OYKKKHCWSA-N |
| XLogP | 5.23 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|