C21H17N3O6 — CID 140544856
methyl N-[[(2Z)-2-[(5-methoxy-1H-indol-3-yl)methylidene]-3-oxo-1-benzofuran-5-yl]carbamoyl]carbamate (PubChem CID 140544856) has the molecular formula C21H17N3O6 and a molecular weight of 407.38 g/mol. Its IUPAC name is methyl N-[[(2Z)-2-[(5-methoxy-1H-indol-3-yl)methylidene]-3-oxo-1-benzofuran-5-yl]carbamoyl]carbamate.
| Compound Name | methyl N-[[(2Z)-2-[(5-methoxy-1H-indol-3-yl)methylidene]-3-oxo-1-benzofuran-5-yl]carbamoyl]carbamate |
|---|---|
| PubChem CID | 140544856 |
| Molecular Formula | C21H17N3O6 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | methyl N-[[(2Z)-2-[(5-methoxy-1H-indol-3-yl)methylidene]-3-oxo-1-benzofuran-5-yl]carbamoyl]carbamate |
| SMILES | COC(=O)NC(=O)Nc1ccc2c(c1)C(=O)/C(=C/c1c[nH]c3ccc(OC)cc13)O2 |
| InChI | InChI=1S/C21H17N3O6/c1-28-13-4-5-16-14(9-13)11(10-22-16)7-18-19(25)15-8-12(3-6-17(15)30-18)23-20(26)24-21(27)29-2/h3-10,22H,1-2H3,(H2,23,24,26,27)/b18-7- |
| InChIKey | YVDIHPIMPVPGPX-WSVATBPTSA-N |
| XLogP | 3.68 |
| TPSA | 118.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|