C19H12N2O3 — CID 69000083
(2Z)-2-[(5-methoxy-1H-indol-3-yl)methylidene]-3-oxo-1-benzofuran-5-carbonitrile (PubChem CID 69000083) has the molecular formula C19H12N2O3 and a molecular weight of 316.32 g/mol. Its IUPAC name is (2Z)-2-[(5-methoxy-1H-indol-3-yl)methylidene]-3-oxo-1-benzofuran-5-carbonitrile.
| Compound Name | (2Z)-2-[(5-methoxy-1H-indol-3-yl)methylidene]-3-oxo-1-benzofuran-5-carbonitrile |
|---|---|
| PubChem CID | 69000083 |
| Molecular Formula | C19H12N2O3 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | (2Z)-2-[(5-methoxy-1H-indol-3-yl)methylidene]-3-oxo-1-benzofuran-5-carbonitrile |
| SMILES | COc1ccc2[nH]cc(/C=C3\Oc4ccc(C#N)cc4C3=O)c2c1 |
| InChI | InChI=1S/C19H12N2O3/c1-23-13-3-4-16-14(8-13)12(10-21-16)7-18-19(22)15-6-11(9-20)2-5-17(15)24-18/h2-8,10,21H,1H3/b18-7- |
| InChIKey | KPEPCJJYPTWXST-WSVATBPTSA-N |
| XLogP | 3.66 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|