C33H21NO6 — CID 5159697
[2-(1H-indol-3-ylmethylidene)-3-oxo-1-benzofuran-6-yl] 5-methoxy-2-phenyl-1-benzofuran-3-carboxylate (PubChem CID 5159697) has the molecular formula C33H21NO6 and a molecular weight of 527.53 g/mol. Its IUPAC name is [2-(1H-indol-3-ylmethylidene)-3-oxo-1-benzofuran-6-yl] 5-methoxy-2-phenyl-1-benzofuran-3-carboxylate.
| Compound Name | [2-(1H-indol-3-ylmethylidene)-3-oxo-1-benzofuran-6-yl] 5-methoxy-2-phenyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 5159697 |
| Molecular Formula | C33H21NO6 |
| Molecular Weight | 527.53 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | [2-(1H-indol-3-ylmethylidene)-3-oxo-1-benzofuran-6-yl] 5-methoxy-2-phenyl-1-benzofuran-3-carboxylate |
| SMILES | COc1ccc2oc(-c3ccccc3)c(C(=O)Oc3ccc4c(c3)OC(=Cc3c[nH]c5ccccc35)C4=O)c2c1 |
| InChI | InChI=1S/C33H21NO6/c1-37-21-12-14-27-25(16-21)30(32(40-27)19-7-3-2-4-8-19)33(36)38-22-11-13-24-28(17-22)39-29(31(24)35)15-20-18-34-26-10-6-5-9-23(20)26/h2-18,34H,1H3 |
| InChIKey | JWBQURMNQDGFNQ-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.53 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|