C30H20O7 — CID 6532537
[(2Z)-2-[(5-methylfuran-2-yl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-methoxy-2-phenyl-1-benzofuran-3-carboxylate (PubChem CID 6532537) has the molecular formula C30H20O7 and a molecular weight of 492.48 g/mol. Its IUPAC name is [(2Z)-2-[(5-methylfuran-2-yl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-methoxy-2-phenyl-1-benzofuran-3-carboxylate.
| Compound Name | [(2Z)-2-[(5-methylfuran-2-yl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-methoxy-2-phenyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 6532537 |
| Molecular Formula | C30H20O7 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | [(2Z)-2-[(5-methylfuran-2-yl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-methoxy-2-phenyl-1-benzofuran-3-carboxylate |
| SMILES | COc1ccc2oc(-c3ccccc3)c(C(=O)Oc3ccc4c(c3)O/C(=C\c3ccc(C)o3)C4=O)c2c1 |
| InChI | InChI=1S/C30H20O7/c1-17-8-9-20(34-17)16-26-28(31)22-12-10-21(15-25(22)36-26)35-30(32)27-23-14-19(33-2)11-13-24(23)37-29(27)18-6-4-3-5-7-18/h3-16H,1-2H3/b26-16- |
| InChIKey | NBBKNYCBUXMHLS-QQXSKIMKSA-N |
| XLogP | 6.85 |
| TPSA | 88.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|