C32H21ClO6 — CID 6316143
[(2Z)-2-[(2-chlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-ethoxy-2-phenyl-1-benzofuran-3-carboxylate (PubChem CID 6316143) has the molecular formula C32H21ClO6 and a molecular weight of 536.97 g/mol. Its IUPAC name is [(2Z)-2-[(2-chlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-ethoxy-2-phenyl-1-benzofuran-3-carboxylate.
| Compound Name | [(2Z)-2-[(2-chlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-ethoxy-2-phenyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 6316143 |
| Molecular Formula | C32H21ClO6 |
| Molecular Weight | 536.97 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | [(2Z)-2-[(2-chlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-ethoxy-2-phenyl-1-benzofuran-3-carboxylate |
| SMILES | CCOc1ccc2oc(-c3ccccc3)c(C(=O)Oc3ccc4c(c3)O/C(=C\c3ccccc3Cl)C4=O)c2c1 |
| InChI | InChI=1S/C32H21ClO6/c1-2-36-21-13-15-26-24(17-21)29(31(39-26)19-8-4-3-5-9-19)32(35)37-22-12-14-23-27(18-22)38-28(30(23)34)16-20-10-6-7-11-25(20)33/h3-18H,2H2,1H3/b28-16- |
| InChIKey | LJKZUJUECAGOPK-NTFVMDSBSA-N |
| XLogP | 7.99 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.97 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|